C19H32O10P2 — CID 132582718
bis(diethoxyphosphorylmethyl) bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (PubChem CID 132582718) has the molecular formula C19H32O10P2 and a molecular weight of 482.40 g/mol. Its IUPAC name is bis(diethoxyphosphorylmethyl) bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate.
| Compound Name | bis(diethoxyphosphorylmethyl) bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 132582718 |
| Molecular Formula | C19H32O10P2 |
| Molecular Weight | 482.40 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | bis(diethoxyphosphorylmethyl) bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| SMILES | CCOP(=O)(COC(=O)C1C2C=CC(C2)C1C(=O)OCP(=O)(OCC)OCC)OCC |
| InChI | InChI=1S/C19H32O10P2/c1-5-26-30(22,27-6-2)12-24-18(20)16-14-9-10-15(11-14)17(16)19(21)25-13-31(23,28-7-3)29-8-4/h9-10,14-17H,5-8,11-13H2,1-4H3 |
| InChIKey | UCTRFNGDUMIDMN-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.40 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|