C21H30O6 — CID 132584534
methyl (1R,2R,3S,3aR,4S,7aR)-1-[2-(furan-3-yl)-2-oxoethyl]-3-hydroxy-2-(hydroxymethyl)-2,4,7a-trimethyl-1,3,3a,5,6,7-hexahydroindene-4-carboxylate (PubChem CID 132584534) has the molecular formula C21H30O6 and a molecular weight of 378.47 g/mol. Its IUPAC name is methyl (1R,2R,3S,3aR,4S,7aR)-1-[2-(furan-3-yl)-2-oxoethyl]-3-hydroxy-2-(hydroxymethyl)-2,4,7a-trimethyl-1,3,3a,5,6,7-hexahydroindene-4-carboxylate.
| Compound Name | methyl (1R,2R,3S,3aR,4S,7aR)-1-[2-(furan-3-yl)-2-oxoethyl]-3-hydroxy-2-(hydroxymethyl)-2,4,7a-trimethyl-1,3,3a,5,6,7-hexahydroindene-4-carboxylate |
|---|---|
| PubChem CID | 132584534 |
| Molecular Formula | C21H30O6 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | methyl (1R,2R,3S,3aR,4S,7aR)-1-[2-(furan-3-yl)-2-oxoethyl]-3-hydroxy-2-(hydroxymethyl)-2,4,7a-trimethyl-1,3,3a,5,6,7-hexahydroindene-4-carboxylate |
| SMILES | COC(=O)[C@@]1(C)CCC[C@]2(C)[C@@H](CC(=O)c3ccoc3)[C@](C)(CO)[C@@H](O)[C@H]21 |
| InChI | InChI=1S/C21H30O6/c1-19-7-5-8-20(2,18(25)26-4)16(19)17(24)21(3,12-22)15(19)10-14(23)13-6-9-27-11-13/h6,9,11,15-17,22,24H,5,7-8,10,12H2,1-4H3/t15-,16-,17+,19-,20+,21+/m1/s1 |
| InChIKey | WESRFIQYNXTYCG-AGMFQBESSA-N |
| XLogP | 2.83 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |