C21H34O6 — CID 45115009
methyl (3S,4aS,7S,10aR)-3-ethenyl-1,6-dihydroxy-3-(hydroxymethyl)-4a,7,10a-trimethyl-2,5,6,6a,8,9,10,10b-octahydro-1H-benzo[f]chromene-7-carboxylate (PubChem CID 45115009) has the molecular formula C21H34O6 and a molecular weight of 382.50 g/mol. Its IUPAC name is methyl (3S,4aS,7S,10aR)-3-ethenyl-1,6-dihydroxy-3-(hydroxymethyl)-4a,7,10a-trimethyl-2,5,6,6a,8,9,10,10b-octahydro-1H-benzo[f]chromene-7-carboxylate.
| Compound Name | methyl (3S,4aS,7S,10aR)-3-ethenyl-1,6-dihydroxy-3-(hydroxymethyl)-4a,7,10a-trimethyl-2,5,6,6a,8,9,10,10b-octahydro-1H-benzo[f]chromene-7-carboxylate |
|---|---|
| PubChem CID | 45115009 |
| Molecular Formula | C21H34O6 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | methyl (3S,4aS,7S,10aR)-3-ethenyl-1,6-dihydroxy-3-(hydroxymethyl)-4a,7,10a-trimethyl-2,5,6,6a,8,9,10,10b-octahydro-1H-benzo[f]chromene-7-carboxylate |
| SMILES | C=C[C@]1(CO)CC(O)C2[C@]3(C)CCC[C@](C)(C(=O)OC)C3C(O)C[C@]2(C)O1 |
| InChI | InChI=1S/C21H34O6/c1-6-21(12-22)11-14(24)16-18(2)8-7-9-19(3,17(25)26-5)15(18)13(23)10-20(16,4)27-21/h6,13-16,22-24H,1,7-12H2,2-5H3/t13?,14?,15?,16?,18-,19+,20+,21-/m1/s1 |
| InChIKey | GGZPAORYLBTVJF-LDRZPAJXSA-N |
| XLogP | 1.81 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|