C20H24O5 — CID 163048442
(1S,5R,8R,10S,13R,14R)-14-[2-(furan-3-yl)-2-oxoethyl]-5,10-dimethyl-7,9-dioxatetracyclo[8.3.1.01,8.05,13]tetradecan-6-one (PubChem CID 163048442) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is (1S,5R,8R,10S,13R,14R)-14-[2-(furan-3-yl)-2-oxoethyl]-5,10-dimethyl-7,9-dioxatetracyclo[8.3.1.01,8.05,13]tetradecan-6-one.
| Compound Name | (1S,5R,8R,10S,13R,14R)-14-[2-(furan-3-yl)-2-oxoethyl]-5,10-dimethyl-7,9-dioxatetracyclo[8.3.1.01,8.05,13]tetradecan-6-one |
|---|---|
| PubChem CID | 163048442 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (1S,5R,8R,10S,13R,14R)-14-[2-(furan-3-yl)-2-oxoethyl]-5,10-dimethyl-7,9-dioxatetracyclo[8.3.1.01,8.05,13]tetradecan-6-one |
| SMILES | C[C@]12CCC[C@]34[C@@H](OC1=O)O[C@@](C)(CC[C@H]32)[C@@H]4CC(=O)c1ccoc1 |
| InChI | InChI=1S/C20H24O5/c1-18-6-3-7-20-14(18)4-8-19(2,25-17(20)24-16(18)22)15(20)10-13(21)12-5-9-23-11-12/h5,9,11,14-15,17H,3-4,6-8,10H2,1-2H3/t14-,15-,17-,18+,19-,20-/m0/s1 |
| InChIKey | COSWXWSVBYDRKX-BEUOHLRXSA-N |
| XLogP | 3.73 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |