C11H16F3N3O2 — CID 132586066
tert-butyl 2-[4-amino-3-(trifluoromethyl)pyrazol-1-yl]propanoate (PubChem CID 132586066) has the molecular formula C11H16F3N3O2 and a molecular weight of 279.26 g/mol. Its IUPAC name is tert-butyl 2-[4-amino-3-(trifluoromethyl)pyrazol-1-yl]propanoate.
| Compound Name | tert-butyl 2-[4-amino-3-(trifluoromethyl)pyrazol-1-yl]propanoate |
|---|---|
| PubChem CID | 132586066 |
| Molecular Formula | C11H16F3N3O2 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | tert-butyl 2-[4-amino-3-(trifluoromethyl)pyrazol-1-yl]propanoate |
| SMILES | CC(C(=O)OC(C)(C)C)n1cc(N)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C11H16F3N3O2/c1-6(9(18)19-10(2,3)4)17-5-7(15)8(16-17)11(12,13)14/h5-6H,15H2,1-4H3 |
| InChIKey | BYNHNPXFNLZWTE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |