C10H13F3N2Si — CID 132586199
trimethyl-[2-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]ethynyl]silane (PubChem CID 132586199) has the molecular formula C10H13F3N2Si and a molecular weight of 246.31 g/mol. Its IUPAC name is trimethyl-[2-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]ethynyl]silane.
| Compound Name | trimethyl-[2-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]ethynyl]silane |
|---|---|
| PubChem CID | 132586199 |
| Molecular Formula | C10H13F3N2Si |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | trimethyl-[2-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]ethynyl]silane |
| SMILES | C[Si](C)(C)C#Cc1ccn(CC(F)(F)F)n1 |
| InChI | InChI=1S/C10H13F3N2Si/c1-16(2,3)7-5-9-4-6-15(14-9)8-10(11,12)13/h4,6H,8H2,1-3H3 |
| InChIKey | ZLKYFFAACCOQCM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|