C15H23NO6 — CID 13258846
triethyl 2-azabicyclo[2.2.1]heptane-2,3,3-tricarboxylate (PubChem CID 13258846) has the molecular formula C15H23NO6 and a molecular weight of 313.35 g/mol. Its IUPAC name is triethyl 2-azabicyclo[2.2.1]heptane-2,3,3-tricarboxylate.
| Compound Name | triethyl 2-azabicyclo[2.2.1]heptane-2,3,3-tricarboxylate |
|---|---|
| PubChem CID | 13258846 |
| Molecular Formula | C15H23NO6 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | triethyl 2-azabicyclo[2.2.1]heptane-2,3,3-tricarboxylate |
| SMILES | CCOC(=O)N1C2CCC(C2)C1(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C15H23NO6/c1-4-20-12(17)15(13(18)21-5-2)10-7-8-11(9-10)16(15)14(19)22-6-3/h10-11H,4-9H2,1-3H3 |
| InChIKey | DRWFHGKWFVQYBZ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|