C22H35NO4 — CID 175505146
ethyl 1,4-bis(4-formylcyclohexyl)piperidine-4-carboxylate (PubChem CID 175505146) has the molecular formula C22H35NO4 and a molecular weight of 377.53 g/mol. Its IUPAC name is ethyl 1,4-bis(4-formylcyclohexyl)piperidine-4-carboxylate.
| Compound Name | ethyl 1,4-bis(4-formylcyclohexyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 175505146 |
| Molecular Formula | C22H35NO4 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.26 |
| IUPAC Name | ethyl 1,4-bis(4-formylcyclohexyl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1(C2CCC(C=O)CC2)CCN(C2CCC(C=O)CC2)CC1 |
| InChI | InChI=1S/C22H35NO4/c1-2-27-21(26)22(19-7-3-17(15-24)4-8-19)11-13-23(14-12-22)20-9-5-18(16-25)6-10-20/h15-20H,2-14H2,1H3 |
| InChIKey | MPOBZBVPNPHXES-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|