C12H7F2NO3 — CID 132589060
2-(3,5-difluorophenyl)-5-hydroxypyridine-4-carboxylic acid (PubChem CID 132589060) has the molecular formula C12H7F2NO3 and a molecular weight of 251.19 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)-5-hydroxypyridine-4-carboxylic acid.
| Compound Name | 2-(3,5-difluorophenyl)-5-hydroxypyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 132589060 |
| Molecular Formula | C12H7F2NO3 |
| Molecular Weight | 251.19 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | 2-(3,5-difluorophenyl)-5-hydroxypyridine-4-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2cc(F)cc(F)c2)ncc1O |
| InChI | InChI=1S/C12H7F2NO3/c13-7-1-6(2-8(14)3-7)10-4-9(12(17)18)11(16)5-15-10/h1-5,16H,(H,17,18) |
| InChIKey | JXVFOHIEAMACHO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.19 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |