2-(3,5-difluorophenyl)-5-hydroxypyridine-4-carboxylic acid

C12H7F2NO3 — CID 132589060

IUPAC2-(3,5-difluorophenyl)-5-hydroxypyridine-4-carboxylic acid
SMILESO=C(O)c1cc(-c2cc(F)cc(F)c2)ncc1O
InChIInChI=1S/C12H7F2NO3/c13-7-1-6(2-8(14)3-7)10-4-9(12(17)18)11(16)5-15-10/h1-5,16H,(H,17,18)
InChIKeyJXVFOHIEAMACHO-UHFFFAOYSA-N
MW251.19 g/mol
LogP2.43
Rot. Bonds2

About 2-(3,5-difluorophenyl)-5-hydroxypyridine-4-carboxylic acid

2-(3,5-difluorophenyl)-5-hydroxypyridine-4-carboxylic acid (PubChem CID 132589060) has the molecular formula C12H7F2NO3 and a molecular weight of 251.19 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)-5-hydroxypyridine-4-carboxylic acid.

Molecular Properties

Compound Name2-(3,5-difluorophenyl)-5-hydroxypyridine-4-carboxylic acid
PubChem CID132589060
Molecular FormulaC12H7F2NO3
Molecular Weight251.19 g/mol
Exact Mass251.04
IUPAC Name2-(3,5-difluorophenyl)-5-hydroxypyridine-4-carboxylic acid
SMILESO=C(O)c1cc(-c2cc(F)cc(F)c2)ncc1O
InChIInChI=1S/C12H7F2NO3/c13-7-1-6(2-8(14)3-7)10-4-9(12(17)18)11(16)5-15-10/h1-5,16H,(H,17,18)
InChIKeyJXVFOHIEAMACHO-UHFFFAOYSA-N
XLogP2.43
TPSA70.42 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500251.19
LogP ≤ 52.43
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-(3,5-difluorophenyl)-5-hydroxypyridine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,5-difluorophenyl)-5-hydroxypyridine-4-carboxylic acid?
The IUPAC name of 2-(3,5-difluorophenyl)-5-hydroxypyridine-4-carboxylic acid (CID 132589060) is 2-(3,5-difluorophenyl)-5-hydroxypyridine-4-carboxylic acid.
What is the SMILES notation for 2-(3,5-difluorophenyl)-5-hydroxypyridine-4-carboxylic acid?
The canonical SMILES for 2-(3,5-difluorophenyl)-5-hydroxypyridine-4-carboxylic acid is O=C(O)c1cc(-c2cc(F)cc(F)c2)ncc1O.
What is the InChIKey of 2-(3,5-difluorophenyl)-5-hydroxypyridine-4-carboxylic acid?
The InChIKey is JXVFOHIEAMACHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7F2NO3/c13-7-1-6(2-8(14)3-7)10-4-9(12(17)18)11(16)5-15-10/h1-5,16H,(H,17,18).
What are the key properties of 2-(3,5-difluorophenyl)-5-hydroxypyridine-4-carboxylic acid?
2-(3,5-difluorophenyl)-5-hydroxypyridine-4-carboxylic acid has a molecular weight of 251.19 g/mol, XLogP of 2.43, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-difluorophenyl)-5-hydroxypyridine-4-carboxylic acid is sourced from PubChem (CID 132589060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).