C22H15F3N2O5 — CID 143975575
2-[3-cyano-4-[4-[2-(trifluoromethoxy)ethoxy]phenyl]phenyl]-5-hydroxypyridine-4-carboxylic acid (PubChem CID 143975575) has the molecular formula C22H15F3N2O5 and a molecular weight of 444.37 g/mol. Its IUPAC name is 2-[3-cyano-4-[4-[2-(trifluoromethoxy)ethoxy]phenyl]phenyl]-5-hydroxypyridine-4-carboxylic acid.
| Compound Name | 2-[3-cyano-4-[4-[2-(trifluoromethoxy)ethoxy]phenyl]phenyl]-5-hydroxypyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 143975575 |
| Molecular Formula | C22H15F3N2O5 |
| Molecular Weight | 444.37 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | 2-[3-cyano-4-[4-[2-(trifluoromethoxy)ethoxy]phenyl]phenyl]-5-hydroxypyridine-4-carboxylic acid |
| SMILES | N#Cc1cc(-c2cc(C(=O)O)c(O)cn2)ccc1-c1ccc(OCCOC(F)(F)F)cc1 |
| InChI | InChI=1S/C22H15F3N2O5/c23-22(24,25)32-8-7-31-16-4-1-13(2-5-16)17-6-3-14(9-15(17)11-26)19-10-18(21(29)30)20(28)12-27-19/h1-6,9-10,12,28H,7-8H2,(H,29,30) |
| InChIKey | FEOHPZUXPOKNSZ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 112.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.37 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|