C16H10N4O3 — CID 45377527
2-(3-cyano-4-imidazol-1-ylphenyl)-5-hydroxypyridine-4-carboxylic acid (PubChem CID 45377527) has the molecular formula C16H10N4O3 and a molecular weight of 306.28 g/mol. Its IUPAC name is 2-(3-cyano-4-imidazol-1-ylphenyl)-5-hydroxypyridine-4-carboxylic acid.
| Compound Name | 2-(3-cyano-4-imidazol-1-ylphenyl)-5-hydroxypyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 45377527 |
| Molecular Formula | C16H10N4O3 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 2-(3-cyano-4-imidazol-1-ylphenyl)-5-hydroxypyridine-4-carboxylic acid |
| SMILES | N#Cc1cc(-c2cc(C(=O)O)c(O)cn2)ccc1-n1ccnc1 |
| InChI | InChI=1S/C16H10N4O3/c17-7-11-5-10(1-2-14(11)20-4-3-18-9-20)13-6-12(16(22)23)15(21)8-19-13/h1-6,8-9,21H,(H,22,23) |
| InChIKey | VKTYQWWPOQOPCA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 112.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |