C17H10N2O3S — CID 45257151
2-(4-cyano-5-phenylthiophen-2-yl)-5-hydroxypyridine-4-carboxylic acid (PubChem CID 45257151) has the molecular formula C17H10N2O3S and a molecular weight of 322.35 g/mol. Its IUPAC name is 2-(4-cyano-5-phenylthiophen-2-yl)-5-hydroxypyridine-4-carboxylic acid.
| Compound Name | 2-(4-cyano-5-phenylthiophen-2-yl)-5-hydroxypyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 45257151 |
| Molecular Formula | C17H10N2O3S |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 2-(4-cyano-5-phenylthiophen-2-yl)-5-hydroxypyridine-4-carboxylic acid |
| SMILES | N#Cc1cc(-c2cc(C(=O)O)c(O)cn2)sc1-c1ccccc1 |
| InChI | InChI=1S/C17H10N2O3S/c18-8-11-6-15(23-16(11)10-4-2-1-3-5-10)13-7-12(17(21)22)14(20)9-19-13/h1-7,9,20H,(H,21,22) |
| InChIKey | BIJZGIPNMCHFGP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 94.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |