C17H10N2O2S — CID 45376372
2-(4-cyano-5-phenylthiophen-2-yl)pyridine-4-carboxylic acid (PubChem CID 45376372) has the molecular formula C17H10N2O2S and a molecular weight of 306.35 g/mol. Its IUPAC name is 2-(4-cyano-5-phenylthiophen-2-yl)pyridine-4-carboxylic acid.
| Compound Name | 2-(4-cyano-5-phenylthiophen-2-yl)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 45376372 |
| Molecular Formula | C17H10N2O2S |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 2-(4-cyano-5-phenylthiophen-2-yl)pyridine-4-carboxylic acid |
| SMILES | N#Cc1cc(-c2cc(C(=O)O)ccn2)sc1-c1ccccc1 |
| InChI | InChI=1S/C17H10N2O2S/c18-10-13-9-15(14-8-12(17(20)21)6-7-19-14)22-16(13)11-4-2-1-3-5-11/h1-9H,(H,20,21) |
| InChIKey | OBSHALFDUOUCGA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 73.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |