About methyl 6-chloro-2-(2,4-dichlorophenyl)thieno[3,2-b]furan-5-carboxylate
methyl 6-chloro-2-(2,4-dichlorophenyl)thieno[3,2-b]furan-5-carboxylate (PubChem CID 132590869) has the molecular formula C14H7Cl3O3S
and a molecular weight of 361.63 g/mol. Its IUPAC name is methyl 6-chloro-2-(2,4-dichlorophenyl)thieno[3,2-b]furan-5-carboxylate.
Molecular Properties
| Compound Name | methyl 6-chloro-2-(2,4-dichlorophenyl)thieno[3,2-b]furan-5-carboxylate |
| PubChem CID | 132590869 |
| Molecular Formula | C14H7Cl3O3S |
| Molecular Weight | 361.63 g/mol |
| Exact Mass | 359.92 |
| IUPAC Name | methyl 6-chloro-2-(2,4-dichlorophenyl)thieno[3,2-b]furan-5-carboxylate |
| SMILES | COC(=O)c1sc2cc(-c3ccc(Cl)cc3Cl)oc2c1Cl |
| InChI | InChI=1S/C14H7Cl3O3S/c1-19-14(18)13-11(17)12-10(21-13)5-9(20-12)7-3-2-6(15)4-8(7)16/h2-5H,1H3 |
| InChIKey | ATEJXZUOAILQID-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 361.63 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 6-chloro-2-(2,4-dichlorophenyl)thieno[3,2-b]furan-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-chloro-2-(2,4-dichlorophenyl)thieno[3,2-b]furan-5-carboxylate?
The IUPAC name of methyl 6-chloro-2-(2,4-dichlorophenyl)thieno[3,2-b]furan-5-carboxylate (CID 132590869) is methyl 6-chloro-2-(2,4-dichlorophenyl)thieno[3,2-b]furan-5-carboxylate.
What is the SMILES notation for methyl 6-chloro-2-(2,4-dichlorophenyl)thieno[3,2-b]furan-5-carboxylate?
The canonical SMILES for methyl 6-chloro-2-(2,4-dichlorophenyl)thieno[3,2-b]furan-5-carboxylate is COC(=O)c1sc2cc(-c3ccc(Cl)cc3Cl)oc2c1Cl.
What is the InChIKey of methyl 6-chloro-2-(2,4-dichlorophenyl)thieno[3,2-b]furan-5-carboxylate?
The InChIKey is ATEJXZUOAILQID-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H7Cl3O3S/c1-19-14(18)13-11(17)12-10(21-13)5-9(20-12)7-3-2-6(15)4-8(7)16/h2-5H,1H3.
What are the key properties of methyl 6-chloro-2-(2,4-dichlorophenyl)thieno[3,2-b]furan-5-carboxylate?
methyl 6-chloro-2-(2,4-dichlorophenyl)thieno[3,2-b]furan-5-carboxylate has a molecular weight of 361.63 g/mol, XLogP of 5.91, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-chloro-2-(2,4-dichlorophenyl)thieno[3,2-b]furan-5-carboxylate is sourced from PubChem (CID 132590869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).