C18H19BrN2O3S — CID 132591262
3-bromo-N-carbamothioyl-5-ethoxy-4-[(3-methylphenyl)methoxy]benzamide (PubChem CID 132591262) has the molecular formula C18H19BrN2O3S and a molecular weight of 423.33 g/mol. Its IUPAC name is 3-bromo-N-carbamothioyl-5-ethoxy-4-[(3-methylphenyl)methoxy]benzamide.
| Compound Name | 3-bromo-N-carbamothioyl-5-ethoxy-4-[(3-methylphenyl)methoxy]benzamide |
|---|---|
| PubChem CID | 132591262 |
| Molecular Formula | C18H19BrN2O3S |
| Molecular Weight | 423.33 g/mol |
| Exact Mass | 422.03 |
| IUPAC Name | 3-bromo-N-carbamothioyl-5-ethoxy-4-[(3-methylphenyl)methoxy]benzamide |
| SMILES | CCOc1cc(C(=O)NC(N)=S)cc(Br)c1OCc1cccc(C)c1 |
| InChI | InChI=1S/C18H19BrN2O3S/c1-3-23-15-9-13(17(22)21-18(20)25)8-14(19)16(15)24-10-12-6-4-5-11(2)7-12/h4-9H,3,10H2,1-2H3,(H3,20,21,22,25) |
| InChIKey | VTLHEMRVBNOMTR-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.33 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|