C28H26BrN3O3 — CID 6013987
N-[(Z)-[3-bromo-5-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]-2-pyrrol-1-ylbenzamide (PubChem CID 6013987) has the molecular formula C28H26BrN3O3 and a molecular weight of 532.44 g/mol. Its IUPAC name is N-[(Z)-[3-bromo-5-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]-2-pyrrol-1-ylbenzamide.
| Compound Name | N-[(Z)-[3-bromo-5-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]-2-pyrrol-1-ylbenzamide |
|---|---|
| PubChem CID | 6013987 |
| Molecular Formula | C28H26BrN3O3 |
| Molecular Weight | 532.44 g/mol |
| Exact Mass | 531.12 |
| IUPAC Name | N-[(Z)-[3-bromo-5-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]-2-pyrrol-1-ylbenzamide |
| SMILES | CCOc1cc(/C=N\NC(=O)c2ccccc2-n2cccc2)cc(Br)c1OCc1cccc(C)c1 |
| InChI | InChI=1S/C28H26BrN3O3/c1-3-34-26-17-22(16-24(29)27(26)35-19-21-10-8-9-20(2)15-21)18-30-31-28(33)23-11-4-5-12-25(23)32-13-6-7-14-32/h4-18H,3,19H2,1-2H3,(H,31,33)/b30-18- |
| InChIKey | UGQVNFSAHOADPT-YKQZZPSBSA-N |
| XLogP | 6.29 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.44 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|