C14H11BrN2O3S — CID 132591524
3-(5-bromo-2-methoxyphenyl)-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide (PubChem CID 132591524) has the molecular formula C14H11BrN2O3S and a molecular weight of 367.22 g/mol. Its IUPAC name is 3-(5-bromo-2-methoxyphenyl)-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide.
| Compound Name | 3-(5-bromo-2-methoxyphenyl)-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide |
|---|---|
| PubChem CID | 132591524 |
| Molecular Formula | C14H11BrN2O3S |
| Molecular Weight | 367.22 g/mol |
| Exact Mass | 365.97 |
| IUPAC Name | 3-(5-bromo-2-methoxyphenyl)-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide |
| SMILES | COc1ccc(Br)cc1C1=NS(=O)(=O)c2ccccc2N1 |
| InChI | InChI=1S/C14H11BrN2O3S/c1-20-12-7-6-9(15)8-10(12)14-16-11-4-2-3-5-13(11)21(18,19)17-14/h2-8H,1H3,(H,16,17) |
| InChIKey | GMGHBPSMVWIBAB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.22 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |