C21H16Cl3NO — CID 132592115
3-(3-chloroanilino)-3-(3,4-dichlorophenyl)-1-phenylpropan-1-one (PubChem CID 132592115) has the molecular formula C21H16Cl3NO and a molecular weight of 404.72 g/mol. Its IUPAC name is 3-(3-chloroanilino)-3-(3,4-dichlorophenyl)-1-phenylpropan-1-one.
| Compound Name | 3-(3-chloroanilino)-3-(3,4-dichlorophenyl)-1-phenylpropan-1-one |
|---|---|
| PubChem CID | 132592115 |
| Molecular Formula | C21H16Cl3NO |
| Molecular Weight | 404.72 g/mol |
| Exact Mass | 403.03 |
| IUPAC Name | 3-(3-chloroanilino)-3-(3,4-dichlorophenyl)-1-phenylpropan-1-one |
| SMILES | O=C(CC(Nc1cccc(Cl)c1)c1ccc(Cl)c(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C21H16Cl3NO/c22-16-7-4-8-17(12-16)25-20(15-9-10-18(23)19(24)11-15)13-21(26)14-5-2-1-3-6-14/h1-12,20,25H,13H2 |
| InChIKey | IRGDGRZHCUNXRA-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.72 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |