C27H24ClNO2 — CID 132592599
3-(3-chloroanilino)-3-(4-ethoxyphenyl)-1-naphthalen-2-ylpropan-1-one (PubChem CID 132592599) has the molecular formula C27H24ClNO2 and a molecular weight of 429.95 g/mol. Its IUPAC name is 3-(3-chloroanilino)-3-(4-ethoxyphenyl)-1-naphthalen-2-ylpropan-1-one.
| Compound Name | 3-(3-chloroanilino)-3-(4-ethoxyphenyl)-1-naphthalen-2-ylpropan-1-one |
|---|---|
| PubChem CID | 132592599 |
| Molecular Formula | C27H24ClNO2 |
| Molecular Weight | 429.95 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | 3-(3-chloroanilino)-3-(4-ethoxyphenyl)-1-naphthalen-2-ylpropan-1-one |
| SMILES | CCOc1ccc(C(CC(=O)c2ccc3ccccc3c2)Nc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C27H24ClNO2/c1-2-31-25-14-12-20(13-15-25)26(29-24-9-5-8-23(28)17-24)18-27(30)22-11-10-19-6-3-4-7-21(19)16-22/h3-17,26,29H,2,18H2,1H3 |
| InChIKey | XPBNYSUFAXXUFW-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.95 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |