C15H11Cl2IN4O2 — CID 132592894
5-[4-[(2,6-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]-2H-tetrazole (PubChem CID 132592894) has the molecular formula C15H11Cl2IN4O2 and a molecular weight of 477.09 g/mol. Its IUPAC name is 5-[4-[(2,6-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]-2H-tetrazole.
| Compound Name | 5-[4-[(2,6-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]-2H-tetrazole |
|---|---|
| PubChem CID | 132592894 |
| Molecular Formula | C15H11Cl2IN4O2 |
| Molecular Weight | 477.09 g/mol |
| Exact Mass | 475.93 |
| IUPAC Name | 5-[4-[(2,6-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]-2H-tetrazole |
| SMILES | COc1cc(-c2nn[nH]n2)cc(I)c1OCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C15H11Cl2IN4O2/c1-23-13-6-8(15-19-21-22-20-15)5-12(18)14(13)24-7-9-10(16)3-2-4-11(9)17/h2-6H,7H2,1H3,(H,19,20,21,22) |
| InChIKey | SVJCYMPMKYLSJK-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.09 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|