C28H30BrN3O5 — CID 132596480
diethyl 3-(4-bromophenyl)imino-1'-tert-butyl-1-methyl-5'-oxospiro[indole-2,2'-pyrrole]-3',4'-dicarboxylate (PubChem CID 132596480) has the molecular formula C28H30BrN3O5 and a molecular weight of 568.47 g/mol. Its IUPAC name is diethyl 3-(4-bromophenyl)imino-1'-tert-butyl-1-methyl-5'-oxospiro[indole-2,2'-pyrrole]-3',4'-dicarboxylate.
| Compound Name | diethyl 3-(4-bromophenyl)imino-1'-tert-butyl-1-methyl-5'-oxospiro[indole-2,2'-pyrrole]-3',4'-dicarboxylate |
|---|---|
| PubChem CID | 132596480 |
| Molecular Formula | C28H30BrN3O5 |
| Molecular Weight | 568.47 g/mol |
| Exact Mass | 567.14 |
| IUPAC Name | diethyl 3-(4-bromophenyl)imino-1'-tert-butyl-1-methyl-5'-oxospiro[indole-2,2'-pyrrole]-3',4'-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)C2(/C(=N/c3ccc(Br)cc3)c3ccccc3N2C)N(C(C)(C)C)C1=O |
| InChI | InChI=1S/C28H30BrN3O5/c1-7-36-25(34)21-22(26(35)37-8-2)28(32(24(21)33)27(3,4)5)23(30-18-15-13-17(29)14-16-18)19-11-9-10-12-20(19)31(28)6/h9-16H,7-8H2,1-6H3/b30-23+ |
| InChIKey | VHMNRXJJVWKUJE-JJKYIXSRSA-N |
| XLogP | 4.78 |
| TPSA | 88.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.47 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|