C23H22BrNO5 — CID 57332045
ethyl 1-benzyl-2-(4-bromophenyl)-4-hydroxy-5-oxo-4-(2-oxopropyl)pyrrole-3-carboxylate (PubChem CID 57332045) has the molecular formula C23H22BrNO5 and a molecular weight of 472.34 g/mol. Its IUPAC name is ethyl 1-benzyl-2-(4-bromophenyl)-4-hydroxy-5-oxo-4-(2-oxopropyl)pyrrole-3-carboxylate.
| Compound Name | ethyl 1-benzyl-2-(4-bromophenyl)-4-hydroxy-5-oxo-4-(2-oxopropyl)pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 57332045 |
| Molecular Formula | C23H22BrNO5 |
| Molecular Weight | 472.34 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | ethyl 1-benzyl-2-(4-bromophenyl)-4-hydroxy-5-oxo-4-(2-oxopropyl)pyrrole-3-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccc(Br)cc2)N(Cc2ccccc2)C(=O)C1(O)CC(C)=O |
| InChI | InChI=1S/C23H22BrNO5/c1-3-30-21(27)19-20(17-9-11-18(24)12-10-17)25(14-16-7-5-4-6-8-16)22(28)23(19,29)13-15(2)26/h4-12,29H,3,13-14H2,1-2H3 |
| InChIKey | KDJZVVSMFXMTII-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.34 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |