C11H12Cl2N2O2S — CID 132597146
N-[2,2-dichloro-2-cyano-1-(3-methylphenyl)ethyl]methanesulfonamide (PubChem CID 132597146) has the molecular formula C11H12Cl2N2O2S and a molecular weight of 307.20 g/mol. Its IUPAC name is N-[2,2-dichloro-2-cyano-1-(3-methylphenyl)ethyl]methanesulfonamide.
| Compound Name | N-[2,2-dichloro-2-cyano-1-(3-methylphenyl)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 132597146 |
| Molecular Formula | C11H12Cl2N2O2S |
| Molecular Weight | 307.20 g/mol |
| Exact Mass | 306.00 |
| IUPAC Name | N-[2,2-dichloro-2-cyano-1-(3-methylphenyl)ethyl]methanesulfonamide |
| SMILES | Cc1cccc(C(NS(C)(=O)=O)C(Cl)(Cl)C#N)c1 |
| InChI | InChI=1S/C11H12Cl2N2O2S/c1-8-4-3-5-9(6-8)10(11(12,13)7-14)15-18(2,16)17/h3-6,10,15H,1-2H3 |
| InChIKey | VLIPWJGMGSKGFX-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.20 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|