C36H40Br2S5 — CID 132597213
4,14-dibromo-8,10-bis(5-octylthiophen-2-yl)-3,9,15-trithiatetracyclo[10.3.0.02,6.07,11]pentadeca-1(12),2(6),4,7,10,13-hexaene (PubChem CID 132597213) has the molecular formula C36H40Br2S5 and a molecular weight of 792.86 g/mol. Its IUPAC name is 4,14-dibromo-8,10-bis(5-octylthiophen-2-yl)-3,9,15-trithiatetracyclo[10.3.0.02,6.07,11]pentadeca-1(12),2(6),4,7,10,13-hexaene.
| Compound Name | 4,14-dibromo-8,10-bis(5-octylthiophen-2-yl)-3,9,15-trithiatetracyclo[10.3.0.02,6.07,11]pentadeca-1(12),2(6),4,7,10,13-hexaene |
|---|---|
| PubChem CID | 132597213 |
| Molecular Formula | C36H40Br2S5 |
| Molecular Weight | 792.86 g/mol |
| Exact Mass | 790.01 |
| IUPAC Name | 4,14-dibromo-8,10-bis(5-octylthiophen-2-yl)-3,9,15-trithiatetracyclo[10.3.0.02,6.07,11]pentadeca-1(12),2(6),4,7,10,13-hexaene |
| SMILES | CCCCCCCCc1ccc(-c2sc(-c3ccc(CCCCCCCC)s3)c3c4cc(Br)sc4c4sc(Br)cc4c23)s1 |
| InChI | InChI=1S/C36H40Br2S5/c1-3-5-7-9-11-13-15-23-17-19-27(39-23)35-31-25-21-29(37)41-33(25)34-26(22-30(38)42-34)32(31)36(43-35)28-20-18-24(40-28)16-14-12-10-8-6-4-2/h17-22H,3-16H2,1-2H3 |
| InChIKey | DYEXXLHTRUBDJD-UHFFFAOYSA-N |
| XLogP | 16.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.86 |
| LogP ≤ 5 | 16.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|