C21H23F3O5 — CID 132597863
methyl (2S,3S,4R)-2-hydroxy-7,7-dimethyl-4-(4-methylphenyl)-5-oxo-2-(trifluoromethyl)-3,4,6,8-tetrahydrochromene-3-carboxylate (PubChem CID 132597863) has the molecular formula C21H23F3O5 and a molecular weight of 412.40 g/mol. Its IUPAC name is methyl (2S,3S,4R)-2-hydroxy-7,7-dimethyl-4-(4-methylphenyl)-5-oxo-2-(trifluoromethyl)-3,4,6,8-tetrahydrochromene-3-carboxylate.
| Compound Name | methyl (2S,3S,4R)-2-hydroxy-7,7-dimethyl-4-(4-methylphenyl)-5-oxo-2-(trifluoromethyl)-3,4,6,8-tetrahydrochromene-3-carboxylate |
|---|---|
| PubChem CID | 132597863 |
| Molecular Formula | C21H23F3O5 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | methyl (2S,3S,4R)-2-hydroxy-7,7-dimethyl-4-(4-methylphenyl)-5-oxo-2-(trifluoromethyl)-3,4,6,8-tetrahydrochromene-3-carboxylate |
| SMILES | COC(=O)[C@H]1[C@H](c2ccc(C)cc2)C2=C(CC(C)(C)CC2=O)O[C@]1(O)C(F)(F)F |
| InChI | InChI=1S/C21H23F3O5/c1-11-5-7-12(8-6-11)15-16-13(25)9-19(2,3)10-14(16)29-20(27,21(22,23)24)17(15)18(26)28-4/h5-8,15,17,27H,9-10H2,1-4H3/t15-,17-,20+/m1/s1 |
| InChIKey | CSPLSCOQMFEHBN-MDYRTPRTSA-N |
| XLogP | 3.79 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |