C25H23F3O9 — CID 66759480
2-(acetyloxymethoxycarbonyl)-2-(acetyloxymethyl)-5-oxo-3-phenyl-5-[4-(trifluoromethyl)phenyl]pentanoic acid (PubChem CID 66759480) has the molecular formula C25H23F3O9 and a molecular weight of 524.44 g/mol. Its IUPAC name is 2-(acetyloxymethoxycarbonyl)-2-(acetyloxymethyl)-5-oxo-3-phenyl-5-[4-(trifluoromethyl)phenyl]pentanoic acid.
| Compound Name | 2-(acetyloxymethoxycarbonyl)-2-(acetyloxymethyl)-5-oxo-3-phenyl-5-[4-(trifluoromethyl)phenyl]pentanoic acid |
|---|---|
| PubChem CID | 66759480 |
| Molecular Formula | C25H23F3O9 |
| Molecular Weight | 524.44 g/mol |
| Exact Mass | 524.13 |
| IUPAC Name | 2-(acetyloxymethoxycarbonyl)-2-(acetyloxymethyl)-5-oxo-3-phenyl-5-[4-(trifluoromethyl)phenyl]pentanoic acid |
| SMILES | CC(=O)OCOC(=O)C(COC(C)=O)(C(=O)O)C(CC(=O)c1ccc(C(F)(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H23F3O9/c1-15(29)35-13-24(22(32)33,23(34)37-14-36-16(2)30)20(17-6-4-3-5-7-17)12-21(31)18-8-10-19(11-9-18)25(26,27)28/h3-11,20H,12-14H2,1-2H3,(H,32,33) |
| InChIKey | PDZCTJHRKTZNKQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.44 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|