C20H18F4O2 — CID 162609018
1-[3-fluoro-4-[4-(trifluoromethyl)phenoxy]phenyl]-3,4-dimethylpent-4-en-1-one (PubChem CID 162609018) has the molecular formula C20H18F4O2 and a molecular weight of 366.35 g/mol. Its IUPAC name is 1-[3-fluoro-4-[4-(trifluoromethyl)phenoxy]phenyl]-3,4-dimethylpent-4-en-1-one.
| Compound Name | 1-[3-fluoro-4-[4-(trifluoromethyl)phenoxy]phenyl]-3,4-dimethylpent-4-en-1-one |
|---|---|
| PubChem CID | 162609018 |
| Molecular Formula | C20H18F4O2 |
| Molecular Weight | 366.35 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 1-[3-fluoro-4-[4-(trifluoromethyl)phenoxy]phenyl]-3,4-dimethylpent-4-en-1-one |
| SMILES | C=C(C)C(C)CC(=O)c1ccc(Oc2ccc(C(F)(F)F)cc2)c(F)c1 |
| InChI | InChI=1S/C20H18F4O2/c1-12(2)13(3)10-18(25)14-4-9-19(17(21)11-14)26-16-7-5-15(6-8-16)20(22,23)24/h4-9,11,13H,1,10H2,2-3H3 |
| InChIKey | MQIINTMNJVFDQF-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.35 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|