C28H27NO2 — CID 132598079
[4-[(Z)-[(3Z)-3-[(4-piperidin-1-ylphenyl)methylidene]-2-benzofuran-1-ylidene]methyl]phenyl]methanol (PubChem CID 132598079) has the molecular formula C28H27NO2 and a molecular weight of 409.53 g/mol. Its IUPAC name is [4-[(Z)-[(3Z)-3-[(4-piperidin-1-ylphenyl)methylidene]-2-benzofuran-1-ylidene]methyl]phenyl]methanol.
| Compound Name | [4-[(Z)-[(3Z)-3-[(4-piperidin-1-ylphenyl)methylidene]-2-benzofuran-1-ylidene]methyl]phenyl]methanol |
|---|---|
| PubChem CID | 132598079 |
| Molecular Formula | C28H27NO2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | [4-[(Z)-[(3Z)-3-[(4-piperidin-1-ylphenyl)methylidene]-2-benzofuran-1-ylidene]methyl]phenyl]methanol |
| SMILES | OCc1ccc(/C=c2\o/c(=C\c3ccc(N4CCCCC4)cc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C28H27NO2/c30-20-23-10-8-21(9-11-23)18-27-25-6-2-3-7-26(25)28(31-27)19-22-12-14-24(15-13-22)29-16-4-1-5-17-29/h2-3,6-15,18-19,30H,1,4-5,16-17,20H2/b27-18-,28-19- |
| InChIKey | MMENPQWHSOGSDJ-XROAYDFBSA-N |
| XLogP | 4.57 |
| TPSA | 36.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|