C19H25NS — CID 132598952
1-benzylsulfanyl-N,N-dimethyl-1-phenylbutan-2-amine (PubChem CID 132598952) has the molecular formula C19H25NS and a molecular weight of 299.48 g/mol. Its IUPAC name is 1-benzylsulfanyl-N,N-dimethyl-1-phenylbutan-2-amine.
| Compound Name | 1-benzylsulfanyl-N,N-dimethyl-1-phenylbutan-2-amine |
|---|---|
| PubChem CID | 132598952 |
| Molecular Formula | C19H25NS |
| Molecular Weight | 299.48 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 1-benzylsulfanyl-N,N-dimethyl-1-phenylbutan-2-amine |
| SMILES | CCC(C(SCc1ccccc1)c1ccccc1)N(C)C |
| InChI | InChI=1S/C19H25NS/c1-4-18(20(2)3)19(17-13-9-6-10-14-17)21-15-16-11-7-5-8-12-16/h5-14,18-19H,4,15H2,1-3H3 |
| InChIKey | CUYULCXSUHOIQD-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.48 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |