C27H25NS — CID 102472585
N-[(1R,2R)-2-benzylsulfanyl-1,2-diphenylethyl]aniline (PubChem CID 102472585) has the molecular formula C27H25NS and a molecular weight of 395.57 g/mol. Its IUPAC name is N-[(1R,2R)-2-benzylsulfanyl-1,2-diphenylethyl]aniline.
| Compound Name | N-[(1R,2R)-2-benzylsulfanyl-1,2-diphenylethyl]aniline |
|---|---|
| PubChem CID | 102472585 |
| Molecular Formula | C27H25NS |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | N-[(1R,2R)-2-benzylsulfanyl-1,2-diphenylethyl]aniline |
| SMILES | c1ccc(CS[C@H](c2ccccc2)[C@H](Nc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H25NS/c1-5-13-22(14-6-1)21-29-27(24-17-9-3-10-18-24)26(23-15-7-2-8-16-23)28-25-19-11-4-12-20-25/h1-20,26-28H,21H2/t26-,27-/m1/s1 |
| InChIKey | YWNYAERTTMGHSE-KAYWLYCHSA-N |
| XLogP | 7.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |