C25H29NS — CID 102472586
N-[(1R,2R)-2-(3-methylbutylsulfanyl)-1,2-diphenylethyl]aniline (PubChem CID 102472586) has the molecular formula C25H29NS and a molecular weight of 375.58 g/mol. Its IUPAC name is N-[(1R,2R)-2-(3-methylbutylsulfanyl)-1,2-diphenylethyl]aniline.
| Compound Name | N-[(1R,2R)-2-(3-methylbutylsulfanyl)-1,2-diphenylethyl]aniline |
|---|---|
| PubChem CID | 102472586 |
| Molecular Formula | C25H29NS |
| Molecular Weight | 375.58 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | N-[(1R,2R)-2-(3-methylbutylsulfanyl)-1,2-diphenylethyl]aniline |
| SMILES | CC(C)CCS[C@H](c1ccccc1)[C@H](Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H29NS/c1-20(2)18-19-27-25(22-14-8-4-9-15-22)24(21-12-6-3-7-13-21)26-23-16-10-5-11-17-23/h3-17,20,24-26H,18-19H2,1-2H3/t24-,25-/m1/s1 |
| InChIKey | DNGCEUSAKPUQBZ-JWQCQUIFSA-N |
| XLogP | 7.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.58 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |