C18H23NOS — CID 64613259
2-(2-methoxyethylsulfanyl)-N-methyl-1,2-diphenylethanamine (PubChem CID 64613259) has the molecular formula C18H23NOS and a molecular weight of 301.45 g/mol. Its IUPAC name is 2-(2-methoxyethylsulfanyl)-N-methyl-1,2-diphenylethanamine.
| Compound Name | 2-(2-methoxyethylsulfanyl)-N-methyl-1,2-diphenylethanamine |
|---|---|
| PubChem CID | 64613259 |
| Molecular Formula | C18H23NOS |
| Molecular Weight | 301.45 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 2-(2-methoxyethylsulfanyl)-N-methyl-1,2-diphenylethanamine |
| SMILES | CNC(c1ccccc1)C(SCCOC)c1ccccc1 |
| InChI | InChI=1S/C18H23NOS/c1-19-17(15-9-5-3-6-10-15)18(21-14-13-20-2)16-11-7-4-8-12-16/h3-12,17-19H,13-14H2,1-2H3 |
| InChIKey | UTDIOEOEGZQMRQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.45 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|