C37H36N2O4S — CID 132599363
methyl 4-[(2-cyclohexyl-3-phenylquinolin-4-yl)-[(4-methylphenyl)methyl]sulfamoyl]benzoate (PubChem CID 132599363) has the molecular formula C37H36N2O4S and a molecular weight of 604.77 g/mol. Its IUPAC name is methyl 4-[(2-cyclohexyl-3-phenylquinolin-4-yl)-[(4-methylphenyl)methyl]sulfamoyl]benzoate.
| Compound Name | methyl 4-[(2-cyclohexyl-3-phenylquinolin-4-yl)-[(4-methylphenyl)methyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 132599363 |
| Molecular Formula | C37H36N2O4S |
| Molecular Weight | 604.77 g/mol |
| Exact Mass | 604.24 |
| IUPAC Name | methyl 4-[(2-cyclohexyl-3-phenylquinolin-4-yl)-[(4-methylphenyl)methyl]sulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)N(Cc2ccc(C)cc2)c2c(-c3ccccc3)c(C3CCCCC3)nc3ccccc23)cc1 |
| InChI | InChI=1S/C37H36N2O4S/c1-26-17-19-27(20-18-26)25-39(44(41,42)31-23-21-30(22-24-31)37(40)43-2)36-32-15-9-10-16-33(32)38-35(29-13-7-4-8-14-29)34(36)28-11-5-3-6-12-28/h3,5-6,9-12,15-24,29H,4,7-8,13-14,25H2,1-2H3 |
| InChIKey | DLIOIFVCGLGKJL-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.77 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |