C27H27N3O10 — CID 132599624
2-[4-[2-[[5-[2-[4-(carboxymethoxy)phenoxy]ethylcarbamoyl]pyridine-3-carbonyl]amino]ethoxy]phenoxy]acetic acid (PubChem CID 132599624) has the molecular formula C27H27N3O10 and a molecular weight of 553.52 g/mol. Its IUPAC name is 2-[4-[2-[[5-[2-[4-(carboxymethoxy)phenoxy]ethylcarbamoyl]pyridine-3-carbonyl]amino]ethoxy]phenoxy]acetic acid.
| Compound Name | 2-[4-[2-[[5-[2-[4-(carboxymethoxy)phenoxy]ethylcarbamoyl]pyridine-3-carbonyl]amino]ethoxy]phenoxy]acetic acid |
|---|---|
| PubChem CID | 132599624 |
| Molecular Formula | C27H27N3O10 |
| Molecular Weight | 553.52 g/mol |
| Exact Mass | 553.17 |
| IUPAC Name | 2-[4-[2-[[5-[2-[4-(carboxymethoxy)phenoxy]ethylcarbamoyl]pyridine-3-carbonyl]amino]ethoxy]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(OCCNC(=O)c2cncc(C(=O)NCCOc3ccc(OCC(=O)O)cc3)c2)cc1 |
| InChI | InChI=1S/C27H27N3O10/c31-24(32)16-39-22-5-1-20(2-6-22)37-11-9-29-26(35)18-13-19(15-28-14-18)27(36)30-10-12-38-21-3-7-23(8-4-21)40-17-25(33)34/h1-8,13-15H,9-12,16-17H2,(H,29,35)(H,30,36)(H,31,32)(H,33,34) |
| InChIKey | NKSPMWNMKZXUDX-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 182.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.52 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|