C27H18N4O — CID 132599746
5-amino-3-(4-methylphenyl)-6-oxa-15,22-diazapentacyclo[12.8.0.02,7.08,13.016,21]docosa-1(22),2(7),4,8,10,12,14,16,18,20-decaene-4-carbonitrile (PubChem CID 132599746) has the molecular formula C27H18N4O and a molecular weight of 414.47 g/mol. Its IUPAC name is 5-amino-3-(4-methylphenyl)-6-oxa-15,22-diazapentacyclo[12.8.0.02,7.08,13.016,21]docosa-1(22),2(7),4,8,10,12,14,16,18,20-decaene-4-carbonitrile.
| Compound Name | 5-amino-3-(4-methylphenyl)-6-oxa-15,22-diazapentacyclo[12.8.0.02,7.08,13.016,21]docosa-1(22),2(7),4,8,10,12,14,16,18,20-decaene-4-carbonitrile |
|---|---|
| PubChem CID | 132599746 |
| Molecular Formula | C27H18N4O |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 5-amino-3-(4-methylphenyl)-6-oxa-15,22-diazapentacyclo[12.8.0.02,7.08,13.016,21]docosa-1(22),2(7),4,8,10,12,14,16,18,20-decaene-4-carbonitrile |
| SMILES | Cc1ccc(C2C(C#N)=C(N)Oc3c2c2nc4ccccc4nc2c2ccccc32)cc1 |
| InChI | InChI=1S/C27H18N4O/c1-15-10-12-16(13-11-15)22-19(14-28)27(29)32-26-18-7-3-2-6-17(18)24-25(23(22)26)31-21-9-5-4-8-20(21)30-24/h2-13,22H,29H2,1H3 |
| InChIKey | QOVAZLSFYVGLCW-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 84.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_6666_A(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|