C20H16F2N2O3 — CID 132600265
ethyl 2-(8-benzamidoquinolin-5-yl)-2,2-difluoroacetate (PubChem CID 132600265) has the molecular formula C20H16F2N2O3 and a molecular weight of 370.36 g/mol. Its IUPAC name is ethyl 2-(8-benzamidoquinolin-5-yl)-2,2-difluoroacetate.
| Compound Name | ethyl 2-(8-benzamidoquinolin-5-yl)-2,2-difluoroacetate |
|---|---|
| PubChem CID | 132600265 |
| Molecular Formula | C20H16F2N2O3 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | ethyl 2-(8-benzamidoquinolin-5-yl)-2,2-difluoroacetate |
| SMILES | CCOC(=O)C(F)(F)c1ccc(NC(=O)c2ccccc2)c2ncccc12 |
| InChI | InChI=1S/C20H16F2N2O3/c1-2-27-19(26)20(21,22)15-10-11-16(17-14(15)9-6-12-23-17)24-18(25)13-7-4-3-5-8-13/h3-12H,2H2,1H3,(H,24,25) |
| InChIKey | QJSQUQYZOAJCKA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |