C33H28N2O6 — CID 132604376
ethyl (Z)-4-oxo-2-[(E)-2-[4-[[2-(2-tricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-ynyloxycarbonylamino)acetyl]amino]phenyl]ethenyl]but-2-enoate (PubChem CID 132604376) has the molecular formula C33H28N2O6 and a molecular weight of 548.60 g/mol. Its IUPAC name is ethyl (Z)-4-oxo-2-[(E)-2-[4-[[2-(2-tricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-ynyloxycarbonylamino)acetyl]amino]phenyl]ethenyl]but-2-enoate.
| Compound Name | ethyl (Z)-4-oxo-2-[(E)-2-[4-[[2-(2-tricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-ynyloxycarbonylamino)acetyl]amino]phenyl]ethenyl]but-2-enoate |
|---|---|
| PubChem CID | 132604376 |
| Molecular Formula | C33H28N2O6 |
| Molecular Weight | 548.60 g/mol |
| Exact Mass | 548.19 |
| IUPAC Name | ethyl (Z)-4-oxo-2-[(E)-2-[4-[[2-(2-tricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-ynyloxycarbonylamino)acetyl]amino]phenyl]ethenyl]but-2-enoate |
| SMILES | CCOC(=O)C(=C\C=O)/C=C/c1ccc(NC(=O)CNC(=O)OC2Cc3ccccc3C#Cc3ccccc32)cc1 |
| InChI | InChI=1S/C33H28N2O6/c1-2-40-32(38)26(19-20-36)14-11-23-12-17-28(18-13-23)35-31(37)22-34-33(39)41-30-21-27-9-4-3-7-24(27)15-16-25-8-5-6-10-29(25)30/h3-14,17-20,30H,2,21-22H2,1H3,(H,34,39)(H,35,37)/b14-11+,26-19- |
| InChIKey | JTRLEVWOPLASFP-CTYDWANQSA-N |
| XLogP | 4.75 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.60 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|