C44H43NO4 — CID 160576422
2-tricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-ynyl 4,4,6-trimethyl-8-(2-tricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-ynyloxycarbonylamino)octanoate (PubChem CID 160576422) has the molecular formula C44H43NO4 and a molecular weight of 649.83 g/mol. Its IUPAC name is 2-tricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-ynyl 4,4,6-trimethyl-8-(2-tricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-ynyloxycarbonylamino)octanoate.
| Compound Name | 2-tricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-ynyl 4,4,6-trimethyl-8-(2-tricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-ynyloxycarbonylamino)octanoate |
|---|---|
| PubChem CID | 160576422 |
| Molecular Formula | C44H43NO4 |
| Molecular Weight | 649.83 g/mol |
| Exact Mass | 649.32 |
| IUPAC Name | 2-tricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-ynyl 4,4,6-trimethyl-8-(2-tricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-ynyloxycarbonylamino)octanoate |
| SMILES | CC(CCNC(=O)OC1Cc2ccccc2C#Cc2ccccc21)CC(C)(C)CCC(=O)OC1Cc2ccccc2C#Cc2ccccc21 |
| InChI | InChI=1S/C44H43NO4/c1-31(25-27-45-43(47)49-41-29-37-17-7-5-13-33(37)21-23-35-15-9-11-19-39(35)41)30-44(2,3)26-24-42(46)48-40-28-36-16-6-4-12-32(36)20-22-34-14-8-10-18-38(34)40/h4-19,31,40-41H,24-30H2,1-3H3,(H,45,47) |
| InChIKey | MUPARGSATOEBIZ-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.83 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|