C18H15B — CID 174038123
CID 174038123 (PubChem CID 174038123) has the molecular formula C18H15B and a molecular weight of 242.13 g/mol.
| Compound Name | CID 174038123 |
|---|---|
| PubChem CID | 174038123 |
| Molecular Formula | C18H15B |
| Molecular Weight | 242.13 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | — |
| SMILES | [B][C@H](C)C1Cc2ccccc2C#Cc2ccccc21 |
| InChI | InChI=1S/C18H15B/c1-13(19)18-12-16-8-3-2-6-14(16)10-11-15-7-4-5-9-17(15)18/h2-9,13,18H,12H2,1H3/t13-,18?/m1/s1 |
| InChIKey | MCHLLBYPGHSBMZ-YJJYDOSJSA-N |
| XLogP | 3.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.13 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|