C32H42NO8P — CID 166039946
2-[2-[2-[[4-oxo-4-(2-tricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-ynyl)butanoyl]amino]ethoxy]ethoxy]ethyl dipropan-2-yl phosphate (PubChem CID 166039946) has the molecular formula C32H42NO8P and a molecular weight of 599.66 g/mol. Its IUPAC name is 2-[2-[2-[[4-oxo-4-(2-tricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-ynyl)butanoyl]amino]ethoxy]ethoxy]ethyl dipropan-2-yl phosphate.
| Compound Name | 2-[2-[2-[[4-oxo-4-(2-tricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-ynyl)butanoyl]amino]ethoxy]ethoxy]ethyl dipropan-2-yl phosphate |
|---|---|
| PubChem CID | 166039946 |
| Molecular Formula | C32H42NO8P |
| Molecular Weight | 599.66 g/mol |
| Exact Mass | 599.26 |
| IUPAC Name | 2-[2-[2-[[4-oxo-4-(2-tricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-ynyl)butanoyl]amino]ethoxy]ethoxy]ethyl dipropan-2-yl phosphate |
| SMILES | CC(C)OP(=O)(OCCOCCOCCNC(=O)CCC(=O)C1Cc2ccccc2C#Cc2ccccc21)OC(C)C |
| InChI | InChI=1S/C32H42NO8P/c1-24(2)40-42(36,41-25(3)4)39-22-21-38-20-19-37-18-17-33-32(35)16-15-31(34)30-23-28-11-6-5-9-26(28)13-14-27-10-7-8-12-29(27)30/h5-12,24-25,30H,15-23H2,1-4H3,(H,33,35) |
| InChIKey | NHGDNKWSUUJJEQ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.66 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|