C46H58N4O8S2 — CID 144577154
N,N'-bis[2-[2-[2-[[4-(2,3-dihydro-1H-inden-1-yloxy)phenyl]sulfanylamino]ethoxy]ethoxy]ethyl]butanediamide (PubChem CID 144577154) has the molecular formula C46H58N4O8S2 and a molecular weight of 859.12 g/mol. Its IUPAC name is N,N'-bis[2-[2-[2-[[4-(2,3-dihydro-1H-inden-1-yloxy)phenyl]sulfanylamino]ethoxy]ethoxy]ethyl]butanediamide.
| Compound Name | N,N'-bis[2-[2-[2-[[4-(2,3-dihydro-1H-inden-1-yloxy)phenyl]sulfanylamino]ethoxy]ethoxy]ethyl]butanediamide |
|---|---|
| PubChem CID | 144577154 |
| Molecular Formula | C46H58N4O8S2 |
| Molecular Weight | 859.12 g/mol |
| Exact Mass | 858.37 |
| IUPAC Name | N,N'-bis[2-[2-[2-[[4-(2,3-dihydro-1H-inden-1-yloxy)phenyl]sulfanylamino]ethoxy]ethoxy]ethyl]butanediamide |
| SMILES | O=C(CCC(=O)NCCOCCOCCNSc1ccc(OC2CCc3ccccc32)cc1)NCCOCCOCCNSc1ccc(OC2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C46H58N4O8S2/c51-45(47-23-27-53-31-33-55-29-25-49-59-39-15-11-37(12-16-39)57-43-19-9-35-5-1-3-7-41(35)43)21-22-46(52)48-24-28-54-32-34-56-30-26-50-60-40-17-13-38(14-18-40)58-44-20-10-36-6-2-4-8-42(36)44/h1-8,11-18,43-44,49-50H,9-10,19-34H2,(H,47,51)(H,48,52) |
| InChIKey | ILKKGHLNCIFVCB-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 137.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.12 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|