C34H42N2O8S2 — CID 167151246
(2-hydroxy-5-oxopyrrolidin-1-yl) 2-[[2-methyl-4-[2-methyl-4-(2-tricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-ynyloxycarbonylamino)butan-2-yl]oxybutan-2-yl]disulfanyl]ethyl carbonate (PubChem CID 167151246) has the molecular formula C34H42N2O8S2 and a molecular weight of 670.85 g/mol. Its IUPAC name is (2-hydroxy-5-oxopyrrolidin-1-yl) 2-[[2-methyl-4-[2-methyl-4-(2-tricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-ynyloxycarbonylamino)butan-2-yl]oxybutan-2-yl]disulfanyl]ethyl carbonate.
| Compound Name | (2-hydroxy-5-oxopyrrolidin-1-yl) 2-[[2-methyl-4-[2-methyl-4-(2-tricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-ynyloxycarbonylamino)butan-2-yl]oxybutan-2-yl]disulfanyl]ethyl carbonate |
|---|---|
| PubChem CID | 167151246 |
| Molecular Formula | C34H42N2O8S2 |
| Molecular Weight | 670.85 g/mol |
| Exact Mass | 670.24 |
| IUPAC Name | (2-hydroxy-5-oxopyrrolidin-1-yl) 2-[[2-methyl-4-[2-methyl-4-(2-tricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-ynyloxycarbonylamino)butan-2-yl]oxybutan-2-yl]disulfanyl]ethyl carbonate |
| SMILES | CC(C)(CCNC(=O)OC1Cc2ccccc2C#Cc2ccccc21)OCCC(C)(C)SSCCOC(=O)ON1C(=O)CCC1O |
| InChI | InChI=1S/C34H42N2O8S2/c1-33(2,42-20-18-34(3,4)46-45-22-21-41-32(40)44-36-29(37)15-16-30(36)38)17-19-35-31(39)43-28-23-26-11-6-5-9-24(26)13-14-25-10-7-8-12-27(25)28/h5-12,28-29,37H,15-23H2,1-4H3,(H,35,39) |
| InChIKey | LCSYERKITJPMKG-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 123.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.85 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|