C25H18FO4P — CID 132604512
6-fluoro-5-methoxy-3-(triphenyl-λ5-phosphanylidene)cyclohex-5-ene-1,2,4-trione (PubChem CID 132604512) has the molecular formula C25H18FO4P and a molecular weight of 432.39 g/mol. Its IUPAC name is 6-fluoro-5-methoxy-3-(triphenyl-λ5-phosphanylidene)cyclohex-5-ene-1,2,4-trione.
| Compound Name | 6-fluoro-5-methoxy-3-(triphenyl-λ5-phosphanylidene)cyclohex-5-ene-1,2,4-trione |
|---|---|
| PubChem CID | 132604512 |
| Molecular Formula | C25H18FO4P |
| Molecular Weight | 432.39 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | 6-fluoro-5-methoxy-3-(triphenyl-λ5-phosphanylidene)cyclohex-5-ene-1,2,4-trione |
| SMILES | COc1c(F)c(=O)c(=O)c(=P(c2ccccc2)(c2ccccc2)c2ccccc2)c1=O |
| InChI | InChI=1S/C25H18FO4P/c1-30-24-20(26)21(27)22(28)25(23(24)29)31(17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19/h2-16H,1H3 |
| InChIKey | KAYNJPGRJQKAOD-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.39 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|