C21H15NO2S — CID 132606635
1-benzyl-3-hydroxy-3-(2-thiophen-3-ylethynyl)indol-2-one (PubChem CID 132606635) has the molecular formula C21H15NO2S and a molecular weight of 345.42 g/mol. Its IUPAC name is 1-benzyl-3-hydroxy-3-(2-thiophen-3-ylethynyl)indol-2-one.
| Compound Name | 1-benzyl-3-hydroxy-3-(2-thiophen-3-ylethynyl)indol-2-one |
|---|---|
| PubChem CID | 132606635 |
| Molecular Formula | C21H15NO2S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 1-benzyl-3-hydroxy-3-(2-thiophen-3-ylethynyl)indol-2-one |
| SMILES | O=C1N(Cc2ccccc2)c2ccccc2C1(O)C#Cc1ccsc1 |
| InChI | InChI=1S/C21H15NO2S/c23-20-21(24,12-10-17-11-13-25-15-17)18-8-4-5-9-19(18)22(20)14-16-6-2-1-3-7-16/h1-9,11,13,15,24H,14H2 |
| InChIKey | CQQRVJFNSLIVAO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|