C26H26ClIN2O3 — CID 132631439
2-[(2-chlorophenyl)methyl-[2-(4-iodophenoxy)acetyl]amino]-N-ethyl-3-phenylpropanamide (PubChem CID 132631439) has the molecular formula C26H26ClIN2O3 and a molecular weight of 576.86 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl-[2-(4-iodophenoxy)acetyl]amino]-N-ethyl-3-phenylpropanamide.
| Compound Name | 2-[(2-chlorophenyl)methyl-[2-(4-iodophenoxy)acetyl]amino]-N-ethyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 132631439 |
| Molecular Formula | C26H26ClIN2O3 |
| Molecular Weight | 576.86 g/mol |
| Exact Mass | 576.07 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl-[2-(4-iodophenoxy)acetyl]amino]-N-ethyl-3-phenylpropanamide |
| SMILES | CCNC(=O)C(Cc1ccccc1)N(Cc1ccccc1Cl)C(=O)COc1ccc(I)cc1 |
| InChI | InChI=1S/C26H26ClIN2O3/c1-2-29-26(32)24(16-19-8-4-3-5-9-19)30(17-20-10-6-7-11-23(20)27)25(31)18-33-22-14-12-21(28)13-15-22/h3-15,24H,2,16-18H2,1H3,(H,29,32) |
| InChIKey | DWMRLCTUYIDSHR-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.86 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|