C20H22ClIN2O3 — CID 132680023
2-[(2-chlorophenyl)methyl-[2-(4-iodophenoxy)acetyl]amino]-N-ethylpropanamide (PubChem CID 132680023) has the molecular formula C20H22ClIN2O3 and a molecular weight of 500.76 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl-[2-(4-iodophenoxy)acetyl]amino]-N-ethylpropanamide.
| Compound Name | 2-[(2-chlorophenyl)methyl-[2-(4-iodophenoxy)acetyl]amino]-N-ethylpropanamide |
|---|---|
| PubChem CID | 132680023 |
| Molecular Formula | C20H22ClIN2O3 |
| Molecular Weight | 500.76 g/mol |
| Exact Mass | 500.04 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl-[2-(4-iodophenoxy)acetyl]amino]-N-ethylpropanamide |
| SMILES | CCNC(=O)C(C)N(Cc1ccccc1Cl)C(=O)COc1ccc(I)cc1 |
| InChI | InChI=1S/C20H22ClIN2O3/c1-3-23-20(26)14(2)24(12-15-6-4-5-7-18(15)21)19(25)13-27-17-10-8-16(22)9-11-17/h4-11,14H,3,12-13H2,1-2H3,(H,23,26) |
| InChIKey | PUYOPAKQZRJDJI-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.76 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|