C23H28ClIN2O3 — CID 132736841
N-butyl-2-[(2-chlorophenyl)methyl-[2-(4-iodophenoxy)acetyl]amino]butanamide (PubChem CID 132736841) has the molecular formula C23H28ClIN2O3 and a molecular weight of 542.85 g/mol. Its IUPAC name is N-butyl-2-[(2-chlorophenyl)methyl-[2-(4-iodophenoxy)acetyl]amino]butanamide.
| Compound Name | N-butyl-2-[(2-chlorophenyl)methyl-[2-(4-iodophenoxy)acetyl]amino]butanamide |
|---|---|
| PubChem CID | 132736841 |
| Molecular Formula | C23H28ClIN2O3 |
| Molecular Weight | 542.85 g/mol |
| Exact Mass | 542.08 |
| IUPAC Name | N-butyl-2-[(2-chlorophenyl)methyl-[2-(4-iodophenoxy)acetyl]amino]butanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1ccccc1Cl)C(=O)COc1ccc(I)cc1 |
| InChI | InChI=1S/C23H28ClIN2O3/c1-3-5-14-26-23(29)21(4-2)27(15-17-8-6-7-9-20(17)24)22(28)16-30-19-12-10-18(25)11-13-19/h6-13,21H,3-5,14-16H2,1-2H3,(H,26,29) |
| InChIKey | NIDACNRHOUKEQE-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.85 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|