C31H36N4O6S — CID 132634253
2-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]-[(2-methylphenyl)methyl]amino]-N-cyclohexylpropanamide (PubChem CID 132634253) has the molecular formula C31H36N4O6S and a molecular weight of 592.72 g/mol. Its IUPAC name is 2-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]-[(2-methylphenyl)methyl]amino]-N-cyclohexylpropanamide.
| Compound Name | 2-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]-[(2-methylphenyl)methyl]amino]-N-cyclohexylpropanamide |
|---|---|
| PubChem CID | 132634253 |
| Molecular Formula | C31H36N4O6S |
| Molecular Weight | 592.72 g/mol |
| Exact Mass | 592.24 |
| IUPAC Name | 2-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]-[(2-methylphenyl)methyl]amino]-N-cyclohexylpropanamide |
| SMILES | Cc1ccccc1CN(C(=O)CN(c1cccc([N+](=O)[O-])c1)S(=O)(=O)c1ccccc1)C(C)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C31H36N4O6S/c1-23-12-9-10-13-25(23)21-33(24(2)31(37)32-26-14-5-3-6-15-26)30(36)22-34(27-16-11-17-28(20-27)35(38)39)42(40,41)29-18-7-4-8-19-29/h4,7-13,16-20,24,26H,3,5-6,14-15,21-22H2,1-2H3,(H,32,37) |
| InChIKey | PCCJLUCOIVVLSP-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.72 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|