C30H33FN4O6S — CID 100555157
(2S)-2-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]-[(2-fluorophenyl)methyl]amino]-N-cyclohexylpropanamide (PubChem CID 100555157) has the molecular formula C30H33FN4O6S and a molecular weight of 596.68 g/mol. Its IUPAC name is (2S)-2-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]-[(2-fluorophenyl)methyl]amino]-N-cyclohexylpropanamide.
| Compound Name | (2S)-2-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]-[(2-fluorophenyl)methyl]amino]-N-cyclohexylpropanamide |
|---|---|
| PubChem CID | 100555157 |
| Molecular Formula | C30H33FN4O6S |
| Molecular Weight | 596.68 g/mol |
| Exact Mass | 596.21 |
| IUPAC Name | (2S)-2-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]-[(2-fluorophenyl)methyl]amino]-N-cyclohexylpropanamide |
| SMILES | C[C@@H](C(=O)NC1CCCCC1)N(Cc1ccccc1F)C(=O)CN(c1cccc([N+](=O)[O-])c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C30H33FN4O6S/c1-22(30(37)32-24-12-4-2-5-13-24)33(20-23-11-8-9-18-28(23)31)29(36)21-34(25-14-10-15-26(19-25)35(38)39)42(40,41)27-16-6-3-7-17-27/h3,6-11,14-19,22,24H,2,4-5,12-13,20-21H2,1H3,(H,32,37)/t22-/m0/s1 |
| InChIKey | MOCRWNHBIBGHAG-QFIPXVFZSA-N |
| XLogP | 4.80 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.68 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|