C10H18O — CID 13263812
(1E,5E)-1-propan-2-yloxyhepta-1,5-diene (PubChem CID 13263812) has the molecular formula C10H18O and a molecular weight of 154.25 g/mol. Its IUPAC name is (1E,5E)-1-propan-2-yloxyhepta-1,5-diene.
| Compound Name | (1E,5E)-1-propan-2-yloxyhepta-1,5-diene |
|---|---|
| PubChem CID | 13263812 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | (1E,5E)-1-propan-2-yloxyhepta-1,5-diene |
| SMILES | C/C=C/CC/C=C/OC(C)C |
| InChI | InChI=1S/C10H18O/c1-4-5-6-7-8-9-11-10(2)3/h4-5,8-10H,6-7H2,1-3H3/b5-4+,9-8+ |
| InChIKey | WYASLKIEPRBIOK-KQWYESAVSA-N |
| XLogP | 3.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|